C22H30BN3O3 — CID 153382045
3-(1-cyclopropylpiperidin-4-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one (PubChem CID 153382045) has the molecular formula C22H30BN3O3 and a molecular weight of 395.31 g/mol. Its IUPAC name is 3-(1-cyclopropylpiperidin-4-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one.
| Compound Name | 3-(1-cyclopropylpiperidin-4-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 153382045 |
| Molecular Formula | C22H30BN3O3 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3-(1-cyclopropylpiperidin-4-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one |
| SMILES | CC1(C)OB(c2ccc3c(=O)n(C4CCN(C5CC5)CC4)cnc3c2)OC1(C)C |
| InChI | InChI=1S/C22H30BN3O3/c1-21(2)22(3,4)29-23(28-21)15-5-8-18-19(13-15)24-14-26(20(18)27)17-9-11-25(12-10-17)16-6-7-16/h5,8,13-14,16-17H,6-7,9-12H2,1-4H3 |
| InChIKey | YKBHYAHETGIHAA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|