About 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one
7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one (PubChem CID 153382130) has the molecular formula C22H23N5O
and a molecular weight of 373.46 g/mol. Its IUPAC name is 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one.
Molecular Properties
| Compound Name | 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one |
| PubChem CID | 153382130 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one |
| SMILES | Cc1cn2cc(-c3ccc4c(=O)n(C5CCN(C)CC5)cnc4c3)ccc2n1 |
| InChI | InChI=1S/C22H23N5O/c1-15-12-26-13-17(4-6-21(26)24-15)16-3-5-19-20(11-16)23-14-27(22(19)28)18-7-9-25(2)10-8-18/h3-6,11-14,18H,7-10H2,1-2H3 |
| InChIKey | GBHKHWUOHYEQDT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one?
The IUPAC name of 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one (CID 153382130) is 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one.
What is the SMILES notation for 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one?
The canonical SMILES for 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one is Cc1cn2cc(-c3ccc4c(=O)n(C5CCN(C)CC5)cnc4c3)ccc2n1.
What is the InChIKey of 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one?
The InChIKey is GBHKHWUOHYEQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O/c1-15-12-26-13-17(4-6-21(26)24-15)16-3-5-19-20(11-16)23-14-27(22(19)28)18-7-9-25(2)10-8-18/h3-6,11-14,18H,7-10H2,1-2H3.
What are the key properties of 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one?
7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one has a molecular weight of 373.46 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methylimidazo[1,2-a]pyridin-6-yl)-3-(1-methylpiperidin-4-yl)quinazolin-4-one is sourced from PubChem (CID 153382130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).