C18H13F2NO3S — CID 153382221
(5E)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 153382221) has the molecular formula C18H13F2NO3S and a molecular weight of 361.37 g/mol. Its IUPAC name is (5E)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 153382221 |
| Molecular Formula | C18H13F2NO3S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (5E)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(F)cc2)C(=O)N1CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13F2NO3S/c19-13-5-1-11(2-6-13)9-16-17(23)21(18(24)25-16)10-15(22)12-3-7-14(20)8-4-12/h1-9,15,22H,10H2/b16-9+ |
| InChIKey | DTPYNPOFNQPGLB-CXUHLZMHSA-N |
| XLogP | 3.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|