C39H29BF2N4S2 — CID 153382366
2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-5,11-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 153382366) has the molecular formula C39H29BF2N4S2 and a molecular weight of 666.63 g/mol. Its IUPAC name is 2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-5,11-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-5,11-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 153382366 |
| Molecular Formula | C39H29BF2N4S2 |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.19 |
| IUPAC Name | 2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-5,11-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(c2cccs2)C(/C=C/c2ccncc2)=[N+]2C1=C(c1ccccc1)c1c(C)c(-c3cccs3)c(/C=C/c3ccncc3)n1[B-]2(F)F |
| InChI | InChI=1S/C39H29BF2N4S2/c1-26-35(33-10-6-24-47-33)31(14-12-28-16-20-43-21-17-28)45-38(26)37(30-8-4-3-5-9-30)39-27(2)36(34-11-7-25-48-34)32(46(39)40(45,41)42)15-13-29-18-22-44-23-19-29/h3-25H,1-2H3/b14-12+,15-13+ |
| InChIKey | KVJUDCXIAXZPON-QUMQEAAQSA-N |
| XLogP | 10.20 |
| TPSA | 33.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|