C32H44N4O — CID 153382667
5-[(2Z)-1-ethenyl-2-ethylidene-4-pyridinyl]-2-[(2E,4Z)-5-methyl-4-(methyldiazenyl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)hexa-2,4-dien-2-yl]phenol (PubChem CID 153382667) has the molecular formula C32H44N4O and a molecular weight of 500.73 g/mol. Its IUPAC name is 5-[(2Z)-1-ethenyl-2-ethylidene-4-pyridinyl]-2-[(2E,4Z)-5-methyl-4-(methyldiazenyl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)hexa-2,4-dien-2-yl]phenol.
| Compound Name | 5-[(2Z)-1-ethenyl-2-ethylidene-4-pyridinyl]-2-[(2E,4Z)-5-methyl-4-(methyldiazenyl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)hexa-2,4-dien-2-yl]phenol |
|---|---|
| PubChem CID | 153382667 |
| Molecular Formula | C32H44N4O |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 5-[(2Z)-1-ethenyl-2-ethylidene-4-pyridinyl]-2-[(2E,4Z)-5-methyl-4-(methyldiazenyl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)hexa-2,4-dien-2-yl]phenol |
| SMILES | C=CN1C=CC(c2ccc(/C(C)=C/C(/N=N/C)=C(\C)CC3CC(C)(C)NC(C)(C)C3)c(O)c2)=C/C1=C/C |
| InChI | InChI=1S/C32H44N4O/c1-10-27-18-26(14-15-36(27)11-2)25-12-13-28(30(37)19-25)22(3)17-29(34-33-9)23(4)16-24-20-31(5,6)35-32(7,8)21-24/h10-15,17-19,24,35,37H,2,16,20-21H2,1,3-9H3/b22-17+,27-10-,29-23-,34-33+ |
| InChIKey | KEVYFAXUHQRWRX-YPQOATMWSA-N |
| XLogP | 8.36 |
| TPSA | 60.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|