C26H32N8O2 — CID 153382826
2-[5-ethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-b]pyridin-6-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol (PubChem CID 153382826) has the molecular formula C26H32N8O2 and a molecular weight of 488.60 g/mol. Its IUPAC name is 2-[5-ethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-b]pyridin-6-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol.
| Compound Name | 2-[5-ethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-b]pyridin-6-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 153382826 |
| Molecular Formula | C26H32N8O2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 2-[5-ethyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-b]pyridin-6-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol |
| SMILES | CCc1nc2c(cc1-c1ccc(-c3ncnc(OC)n3)cc1O)nnn2C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C26H32N8O2/c1-7-19-18(17-9-8-15(10-21(17)35)22-27-14-28-24(30-22)36-6)11-20-23(29-19)34(33-31-20)16-12-25(2,3)32-26(4,5)13-16/h8-11,14,16,32,35H,7,12-13H2,1-6H3 |
| InChIKey | CVOAWZXBXZFYDU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |