C22H32F2IN8P — CID 153382835
(1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1-iodophosphanylpyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine (PubChem CID 153382835) has the molecular formula C22H32F2IN8P and a molecular weight of 604.43 g/mol. Its IUPAC name is (1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1-iodophosphanylpyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine.
| Compound Name | (1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1-iodophosphanylpyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 153382835 |
| Molecular Formula | C22H32F2IN8P |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | (1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1-iodophosphanylpyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine |
| SMILES | CC1(C)CC(N(N)/C(N)=C(N)/C=C(\N)c2cc(F)c(-c3cnn(PI)c3)cc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C22H32F2IN8P/c1-21(2)8-13(9-22(3,4)31-21)33(29)20(28)19(27)7-18(26)15-6-16(23)14(5-17(15)24)12-10-30-32(11-12)34-25/h5-7,10-11,13,31,34H,8-9,26-29H2,1-4H3/b18-7-,20-19- |
| InChIKey | XQXHRZIEUNAWMS-PKAXEZAOSA-N |
| XLogP | 3.49 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|