About 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride
6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride (PubChem CID 153383029) has the molecular formula C21H23ClN4S
and a molecular weight of 398.96 g/mol. Its IUPAC name is 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride.
Molecular Properties
| Compound Name | 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride |
| PubChem CID | 153383029 |
| Molecular Formula | C21H23ClN4S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride |
| SMILES | Cc1cc(-c2ccc3nc(C4CCNCC4)sc3c2)cc2cn(C)nc12.Cl |
| InChI | InChI=1S/C21H22N4S.ClH/c1-13-9-16(10-17-12-25(2)24-20(13)17)15-3-4-18-19(11-15)26-21(23-18)14-5-7-22-8-6-14;/h3-4,9-12,14,22H,5-8H2,1-2H3;1H |
| InChIKey | DYFSMGAVHMTXSJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride?
The IUPAC name of 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride (CID 153383029) is 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride.
What is the SMILES notation for 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride?
The canonical SMILES for 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride is Cc1cc(-c2ccc3nc(C4CCNCC4)sc3c2)cc2cn(C)nc12.Cl.
What is the InChIKey of 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride?
The InChIKey is DYFSMGAVHMTXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4S.ClH/c1-13-9-16(10-17-12-25(2)24-20(13)17)15-3-4-18-19(11-15)26-21(23-18)14-5-7-22-8-6-14;/h3-4,9-12,14,22H,5-8H2,1-2H3;1H.
What are the key properties of 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride?
6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride has a molecular weight of 398.96 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,7-dimethylindazol-5-yl)-2-piperidin-4-yl-1,3-benzothiazole;hydrochloride is sourced from PubChem (CID 153383029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).