C29H29FN4OS — CID 153383175
5-[2-[(2R)-1-benzyl-2,6-dimethylpiperidin-4-yl]-4-fluoro-1,3-benzothiazol-6-yl]-2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 153383175) has the molecular formula C29H29FN4OS and a molecular weight of 500.64 g/mol. Its IUPAC name is 5-[2-[(2R)-1-benzyl-2,6-dimethylpiperidin-4-yl]-4-fluoro-1,3-benzothiazol-6-yl]-2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 5-[2-[(2R)-1-benzyl-2,6-dimethylpiperidin-4-yl]-4-fluoro-1,3-benzothiazol-6-yl]-2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 153383175 |
| Molecular Formula | C29H29FN4OS |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 5-[2-[(2R)-1-benzyl-2,6-dimethylpiperidin-4-yl]-4-fluoro-1,3-benzothiazol-6-yl]-2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1nc2c(C)cc(-c3cc(F)c4nc(C5CC(C)N(Cc6ccccc6)[C@H](C)C5)sc4c3)nc2o1 |
| InChI | InChI=1S/C29H29FN4OS/c1-16-10-24(32-28-26(16)31-19(4)35-28)21-13-23(30)27-25(14-21)36-29(33-27)22-11-17(2)34(18(3)12-22)15-20-8-6-5-7-9-20/h5-10,13-14,17-18,22H,11-12,15H2,1-4H3/t17-,18?,22?/m1/s1 |
| InChIKey | YMCALYAHICLKMA-PDDLGQBUSA-N |
| XLogP | 7.41 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |