About 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride
4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride (PubChem CID 153383265) has the molecular formula C7H8ClN3S
and a molecular weight of 201.68 g/mol. Its IUPAC name is 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride |
| PubChem CID | 153383265 |
| Molecular Formula | C7H8ClN3S |
| Molecular Weight | 201.68 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride |
| SMILES | Cc1nccc2sc(N)nc12.Cl |
| InChI | InChI=1S/C7H7N3S.ClH/c1-4-6-5(2-3-9-4)11-7(8)10-6;/h2-3H,1H3,(H2,8,10);1H |
| InChIKey | MBHFNNRQTQOZAK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.68 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride?
The IUPAC name of 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride (CID 153383265) is 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride.
What is the SMILES notation for 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride?
The canonical SMILES for 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride is Cc1nccc2sc(N)nc12.Cl.
What is the InChIKey of 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride?
The InChIKey is MBHFNNRQTQOZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S.ClH/c1-4-6-5(2-3-9-4)11-7(8)10-6;/h2-3H,1H3,(H2,8,10);1H.
What are the key properties of 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride?
4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride has a molecular weight of 201.68 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-amine;hydrochloride is sourced from PubChem (CID 153383265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).