C16H23BrN4S — CID 153383545
5-bromo-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 153383545) has the molecular formula C16H23BrN4S and a molecular weight of 383.36 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | 5-bromo-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 153383545 |
| Molecular Formula | C16H23BrN4S |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 5-bromo-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | CN(c1nc2ccc(Br)nc2s1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H23BrN4S/c1-15(2)8-10(9-16(3,4)20-15)21(5)14-18-11-6-7-12(17)19-13(11)22-14/h6-7,10,20H,8-9H2,1-5H3 |
| InChIKey | ZWOOUEKALJVRPI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|