C10H10FNO4 — CID 153384309
7-fluoro-5,5-dimethyl-2-nitrocyclohepta-1,3,6-triene-1-carboxylic acid (PubChem CID 153384309) has the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. Its IUPAC name is 7-fluoro-5,5-dimethyl-2-nitrocyclohepta-1,3,6-triene-1-carboxylic acid.
| Compound Name | 7-fluoro-5,5-dimethyl-2-nitrocyclohepta-1,3,6-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 153384309 |
| Molecular Formula | C10H10FNO4 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 7-fluoro-5,5-dimethyl-2-nitrocyclohepta-1,3,6-triene-1-carboxylic acid |
| SMILES | CC1(C)C=CC([N+](=O)[O-])=C(C(=O)O)C(F)=C1 |
| InChI | InChI=1S/C10H10FNO4/c1-10(2)4-3-7(12(15)16)8(9(13)14)6(11)5-10/h3-5H,1-2H3,(H,13,14) |
| InChIKey | ORDBDJBGGWJAGY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|