C12H18FN — CID 153384496
(5E,7Z)-9-fluoro-N,5-dimethyldeca-5,7,9-trien-3-imine (PubChem CID 153384496) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (5E,7Z)-9-fluoro-N,5-dimethyldeca-5,7,9-trien-3-imine.
| Compound Name | (5E,7Z)-9-fluoro-N,5-dimethyldeca-5,7,9-trien-3-imine |
|---|---|
| PubChem CID | 153384496 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (5E,7Z)-9-fluoro-N,5-dimethyldeca-5,7,9-trien-3-imine |
| SMILES | C=C(F)/C=C\C=C(/C)C/C(CC)=N/C |
| InChI | InChI=1S/C12H18FN/c1-5-12(14-4)9-10(2)7-6-8-11(3)13/h6-8H,3,5,9H2,1-2,4H3/b8-6-,10-7+,14-12+ |
| InChIKey | RQPOKOCEESGAGJ-SHBJENAYSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|