C11H19N6+ — CID 153384621
[2-(5,6-dihydrotriazolo[4,5-b]pyridin-3-yl)-1-(dimethylamino)ethylidene]-dimethylazanium (PubChem CID 153384621) has the molecular formula C11H19N6+ and a molecular weight of 235.31 g/mol. Its IUPAC name is [2-(5,6-dihydrotriazolo[4,5-b]pyridin-3-yl)-1-(dimethylamino)ethylidene]-dimethylazanium.
| Compound Name | [2-(5,6-dihydrotriazolo[4,5-b]pyridin-3-yl)-1-(dimethylamino)ethylidene]-dimethylazanium |
|---|---|
| PubChem CID | 153384621 |
| Molecular Formula | C11H19N6+ |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [2-(5,6-dihydrotriazolo[4,5-b]pyridin-3-yl)-1-(dimethylamino)ethylidene]-dimethylazanium |
| SMILES | CN(C)C(Cn1nnc2c1=NCCC=2)=[N+](C)C |
| InChI | InChI=1S/C11H19N6/c1-15(2)10(16(3)4)8-17-11-9(13-14-17)6-5-7-12-11/h6H,5,7-8H2,1-4H3/q+1 |
| InChIKey | LAFJHLPDWPSOFN-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 49.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|