C44H44N5OS+ — CID 153385055
[9-[4-[2-[10-(aminomethyl)-9-[(2-formylhydrazinyl)methyl]anthracen-2-yl]ethynyl]phenyl]-6-(dimethylamino)-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium (PubChem CID 153385055) has the molecular formula C44H44N5OS+ and a molecular weight of 690.94 g/mol. Its IUPAC name is [9-[4-[2-[10-(aminomethyl)-9-[(2-formylhydrazinyl)methyl]anthracen-2-yl]ethynyl]phenyl]-6-(dimethylamino)-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[4-[2-[10-(aminomethyl)-9-[(2-formylhydrazinyl)methyl]anthracen-2-yl]ethynyl]phenyl]-6-(dimethylamino)-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 153385055 |
| Molecular Formula | C44H44N5OS+ |
| Molecular Weight | 690.94 g/mol |
| Exact Mass | 690.33 |
| IUPAC Name | [9-[4-[2-[10-(aminomethyl)-9-[(2-formylhydrazinyl)methyl]anthracen-2-yl]ethynyl]phenyl]-6-(dimethylamino)-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)S(C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1ccc(C#Cc2ccc3c(CN)c4ccccc4c(CNNC=O)c3c2)cc1 |
| InChI | InChI=1S/C44H43N5OS/c1-48(2)32-18-21-37-42(24-32)51(5,6)43-25-33(49(3)4)19-22-38(43)44(37)31-16-13-29(14-17-31)11-12-30-15-20-36-39(23-30)41(27-46-47-28-50)35-10-8-7-9-34(35)40(36)26-45/h7-10,13-25,28,46H,26-27,45H2,1-6H3/p+1 |
| InChIKey | KIMVTJYNLAYACD-UHFFFAOYSA-O |
| XLogP | 7.07 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.94 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|