C15H12N6O4S — CID 153385512
N-[4-amino-1-(1,2-oxazol-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 153385512) has the molecular formula C15H12N6O4S and a molecular weight of 372.37 g/mol. Its IUPAC name is N-[4-amino-1-(1,2-oxazol-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[4-amino-1-(1,2-oxazol-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 153385512 |
| Molecular Formula | C15H12N6O4S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[4-amino-1-(1,2-oxazol-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccon1)NC(=O)c1nsnc1-c1ccccn1 |
| InChI | InChI=1S/C15H12N6O4S/c16-14(23)13(22)10(7-8-4-6-25-19-8)18-15(24)12-11(20-26-21-12)9-3-1-2-5-17-9/h1-6,10H,7H2,(H2,16,23)(H,18,24) |
| InChIKey | SRCFCIJKZOWOBC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|