C17H14N4O4S — CID 153386281
N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2-thiazole-3-carboxamide (PubChem CID 153386281) has the molecular formula C17H14N4O4S and a molecular weight of 370.39 g/mol. Its IUPAC name is N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2-thiazole-3-carboxamide.
| Compound Name | N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 153386281 |
| Molecular Formula | C17H14N4O4S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[4-amino-1-(furan-2-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1,2-thiazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccco1)NC(=O)c1nscc1-c1ccccn1 |
| InChI | InChI=1S/C17H14N4O4S/c18-16(23)15(22)13(8-10-4-3-7-25-10)20-17(24)14-11(9-26-21-14)12-5-1-2-6-19-12/h1-7,9,13H,8H2,(H2,18,23)(H,20,24) |
| InChIKey | HLQGXBONUGINPE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|