C28H30F3NO4Si — CID 15338635
benzyl (2S,4S,5S)-4-benzyl-2-phenyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate (PubChem CID 15338635) has the molecular formula C28H30F3NO4Si and a molecular weight of 529.63 g/mol. Its IUPAC name is benzyl (2S,4S,5S)-4-benzyl-2-phenyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2S,4S,5S)-4-benzyl-2-phenyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15338635 |
| Molecular Formula | C28H30F3NO4Si |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | benzyl (2S,4S,5S)-4-benzyl-2-phenyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
| SMILES | C[Si](C)(C)O[C@@]1(C(F)(F)F)O[C@@H](c2ccccc2)N(C(=O)OCc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H30F3NO4Si/c1-37(2,3)36-27(28(29,30)31)24(19-21-13-7-4-8-14-21)32(25(35-27)23-17-11-6-12-18-23)26(33)34-20-22-15-9-5-10-16-22/h4-18,24-25H,19-20H2,1-3H3/t24-,25-,27-/m0/s1 |
| InChIKey | MAYIZTDGUDJAHZ-KLJDGLGGSA-N |
| XLogP | 7.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|