C24H29N3O2 — CID 153386622
4-[5-tert-butyl-3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2-methylpyrrol-1-yl]benzonitrile (PubChem CID 153386622) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-[5-tert-butyl-3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2-methylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[5-tert-butyl-3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2-methylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 153386622 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 4-[5-tert-butyl-3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2-methylpyrrol-1-yl]benzonitrile |
| SMILES | Cc1c(C(=O)CN2C3CCC2[C@H](O)C3)cc(C(C)(C)C)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-15-19(22(29)14-26-18-9-10-20(26)21(28)11-18)12-23(24(2,3)4)27(15)17-7-5-16(13-25)6-8-17/h5-8,12,18,20-21,28H,9-11,14H2,1-4H3/t18?,20?,21-/m1/s1 |
| InChIKey | ALVQORRXLVKMGB-DQVLVPHSSA-N |
| XLogP | 3.74 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|