C21H22FN3O2 — CID 153386847
3-fluoro-4-[3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzonitrile (PubChem CID 153386847) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 3-fluoro-4-[3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzonitrile.
| Compound Name | 3-fluoro-4-[3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 153386847 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3-fluoro-4-[3-[2-[(2R)-2-hydroxy-7-azabicyclo[2.2.1]heptan-7-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzonitrile |
| SMILES | Cc1cc(C(=O)CN2C3CCC2[C@H](O)C3)c(C)n1-c1ccc(C#N)cc1F |
| InChI | InChI=1S/C21H22FN3O2/c1-12-7-16(21(27)11-24-15-4-6-19(24)20(26)9-15)13(2)25(12)18-5-3-14(10-23)8-17(18)22/h3,5,7-8,15,19-20,26H,4,6,9,11H2,1-2H3/t15?,19?,20-/m1/s1 |
| InChIKey | HDMGJZIFQYXHLE-RGKRWLCDSA-N |
| XLogP | 2.89 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|