C16H22N4O2 — CID 153387213
6-(1-aminoethyl)-N-methyl-11-prop-2-enyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-amine;formaldehyde (PubChem CID 153387213) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 6-(1-aminoethyl)-N-methyl-11-prop-2-enyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-amine;formaldehyde.
| Compound Name | 6-(1-aminoethyl)-N-methyl-11-prop-2-enyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-amine;formaldehyde |
|---|---|
| PubChem CID | 153387213 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 6-(1-aminoethyl)-N-methyl-11-prop-2-enyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-amine;formaldehyde |
| SMILES | C=CCC1COc2cc(C(C)N)cc3nc(NC)n1c23.C=O |
| InChI | InChI=1S/C15H20N4O.CH2O/c1-4-5-11-8-20-13-7-10(9(2)16)6-12-14(13)19(11)15(17-3)18-12;1-2/h4,6-7,9,11H,1,5,8,16H2,2-3H3,(H,17,18);1H2 |
| InChIKey | UTLBMJMMWIGSRA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|