C22H33N3O7 — CID 153387277
(4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxoheptanoic acid (PubChem CID 153387277) has the molecular formula C22H33N3O7 and a molecular weight of 451.52 g/mol. Its IUPAC name is (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxoheptanoic acid.
| Compound Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 153387277 |
| Molecular Formula | C22H33N3O7 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxoheptanoic acid |
| SMILES | CCC(=O)[C@H](CCC(=O)O)NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C22H33N3O7/c1-4-16(26)15(9-12-20(30)31)23-22(32)21(14(2)3)24-17(27)8-6-5-7-13-25-18(28)10-11-19(25)29/h10-11,14-15,21H,4-9,12-13H2,1-3H3,(H,23,32)(H,24,27)(H,30,31)/t15-,21?/m0/s1 |
| InChIKey | AHXRKOPFYKFEKM-ZDGMYTEDSA-N |
| XLogP | 0.94 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|