C22H28N6O2 — CID 153387509
2-aminopyrimidine-5-carbonitrile;[4-(methylamino)phenyl]-(3-methylpiperidin-1-yl)methanone;prop-2-enal (PubChem CID 153387509) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-aminopyrimidine-5-carbonitrile;[4-(methylamino)phenyl]-(3-methylpiperidin-1-yl)methanone;prop-2-enal.
| Compound Name | 2-aminopyrimidine-5-carbonitrile;[4-(methylamino)phenyl]-(3-methylpiperidin-1-yl)methanone;prop-2-enal |
|---|---|
| PubChem CID | 153387509 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-aminopyrimidine-5-carbonitrile;[4-(methylamino)phenyl]-(3-methylpiperidin-1-yl)methanone;prop-2-enal |
| SMILES | C=CC=O.CNc1ccc(C(=O)N2CCCC(C)C2)cc1.N#Cc1cnc(N)nc1 |
| InChI | InChI=1S/C14H20N2O.C5H4N4.C3H4O/c1-11-4-3-9-16(10-11)14(17)12-5-7-13(15-2)8-6-12;6-1-4-2-8-5(7)9-3-4;1-2-3-4/h5-8,11,15H,3-4,9-10H2,1-2H3;2-3H,(H2,7,8,9);2-3H,1H2 |
| InChIKey | BUUQBKQBZDRZRD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|