C15H24BN — CID 15338785
[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-bis(prop-2-enyl)borane (PubChem CID 15338785) has the molecular formula C15H24BN and a molecular weight of 229.18 g/mol. Its IUPAC name is [(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-bis(prop-2-enyl)borane.
| Compound Name | [(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-bis(prop-2-enyl)borane |
|---|---|
| PubChem CID | 15338785 |
| Molecular Formula | C15H24BN |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | [(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-bis(prop-2-enyl)borane |
| SMILES | C=CCB(CC=C)N1[C@H](CC=C)CC=C[C@H]1C |
| InChI | InChI=1S/C15H24BN/c1-5-9-15-11-8-10-14(4)17(15)16(12-6-2)13-7-3/h5-8,10,14-15H,1-3,9,11-13H2,4H3/t14-,15-/m1/s1 |
| InChIKey | YFGYJIJWQUJCSN-HUUCEWRRSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|