C15H13N5O2 — CID 153388660
triazolo[4,5-b]pyridin-3-yl 1,2,3,4-tetrahydroquinoline-7-carboxylate (PubChem CID 153388660) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is triazolo[4,5-b]pyridin-3-yl 1,2,3,4-tetrahydroquinoline-7-carboxylate.
| Compound Name | triazolo[4,5-b]pyridin-3-yl 1,2,3,4-tetrahydroquinoline-7-carboxylate |
|---|---|
| PubChem CID | 153388660 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | triazolo[4,5-b]pyridin-3-yl 1,2,3,4-tetrahydroquinoline-7-carboxylate |
| SMILES | O=C(On1nnc2cccnc21)c1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C15H13N5O2/c21-15(11-6-5-10-3-1-7-16-13(10)9-11)22-20-14-12(18-19-20)4-2-8-17-14/h2,4-6,8-9,16H,1,3,7H2 |
| InChIKey | WUPFVBLQUJMPLK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|