About methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine
methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine (PubChem CID 153389216) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine.
Molecular Properties
| Compound Name | methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine |
| PubChem CID | 153389216 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine |
| SMILES | CCC/C(C)=N\NC.[H]N=C |
| InChI | InChI=1S/C6H14N2.CH3N/c1-4-5-6(2)8-7-3;1-2/h7H,4-5H2,1-3H3;2H,1H2/b8-6-; |
| InChIKey | WOYCVTACHOXSKE-PHZXCRFESA-N |
| XLogP | 1.65 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine?
The IUPAC name of methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine (CID 153389216) is methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine.
What is the SMILES notation for methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine?
The canonical SMILES for methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine is CCC/C(C)=N\NC.[H]N=C.
What is the InChIKey of methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine?
The InChIKey is WOYCVTACHOXSKE-PHZXCRFESA-N. The full InChI is InChI=1S/C6H14N2.CH3N/c1-4-5-6(2)8-7-3;1-2/h7H,4-5H2,1-3H3;2H,1H2/b8-6-;.
What are the key properties of methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine?
methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine has a molecular weight of 143.23 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;N-[(Z)-pentan-2-ylideneamino]methanamine is sourced from PubChem (CID 153389216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).