C12H18F3N — CID 153389453
(Z)-6-methyl-2,5-dimethylidene-N-(2,2,2-trifluoroethyl)hept-3-en-1-amine (PubChem CID 153389453) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is (Z)-6-methyl-2,5-dimethylidene-N-(2,2,2-trifluoroethyl)hept-3-en-1-amine.
| Compound Name | (Z)-6-methyl-2,5-dimethylidene-N-(2,2,2-trifluoroethyl)hept-3-en-1-amine |
|---|---|
| PubChem CID | 153389453 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (Z)-6-methyl-2,5-dimethylidene-N-(2,2,2-trifluoroethyl)hept-3-en-1-amine |
| SMILES | C=C(/C=C\C(=C)C(C)C)CNCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N/c1-9(2)11(4)6-5-10(3)7-16-8-12(13,14)15/h5-6,9,16H,3-4,7-8H2,1-2H3/b6-5- |
| InChIKey | GZLXRXARGLHXRU-WAYWQWQTSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|