About ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate
ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate (PubChem CID 153389535) has the molecular formula C13H29NO2S
and a molecular weight of 263.45 g/mol. Its IUPAC name is ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate |
| PubChem CID | 153389535 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate |
| SMILES | CC.CCSC(C(C)C)C(N)C(=O)OC(C)C |
| InChI | InChI=1S/C11H23NO2S.C2H6/c1-6-15-10(7(2)3)9(12)11(13)14-8(4)5;1-2/h7-10H,6,12H2,1-5H3;1-2H3 |
| InChIKey | NPOAGSXLIIOOGR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate?
The IUPAC name of ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate (CID 153389535) is ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate.
What is the SMILES notation for ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate?
The canonical SMILES for ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate is CC.CCSC(C(C)C)C(N)C(=O)OC(C)C.
What is the InChIKey of ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate?
The InChIKey is NPOAGSXLIIOOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2S.C2H6/c1-6-15-10(7(2)3)9(12)11(13)14-8(4)5;1-2/h7-10H,6,12H2,1-5H3;1-2H3.
What are the key properties of ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate?
ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate has a molecular weight of 263.45 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 2-amino-3-ethylsulfanyl-4-methylpentanoate is sourced from PubChem (CID 153389535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).