About CID 153389575
CID 153389575 (PubChem CID 153389575) has the molecular formula C23H27FNO2S-
and a molecular weight of 400.54 g/mol.
Molecular Properties
| Compound Name | CID 153389575 |
| PubChem CID | 153389575 |
| Molecular Formula | C23H27FNO2S- |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | — |
| SMILES | CCCc1ccc(/[S-](=O)=N/C(=O)Cc2c(C(C)C)cc(F)cc2C2CC2)cc1 |
| InChI | InChI=1S/C23H27FNO2S/c1-4-5-16-6-10-19(11-7-16)28(27)25-23(26)14-22-20(15(2)3)12-18(24)13-21(22)17-8-9-17/h6-7,10-13,15,17H,4-5,8-9,14H2,1-3H3/q-1 |
| InChIKey | PZOFQCAGZAMCHS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 153389575 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153389575?
The IUPAC name of CID 153389575 (CID 153389575) is not available.
What is the SMILES notation for CID 153389575?
The canonical SMILES for CID 153389575 is CCCc1ccc(/[S-](=O)=N/C(=O)Cc2c(C(C)C)cc(F)cc2C2CC2)cc1.
What is the InChIKey of CID 153389575?
The InChIKey is PZOFQCAGZAMCHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27FNO2S/c1-4-5-16-6-10-19(11-7-16)28(27)25-23(26)14-22-20(15(2)3)12-18(24)13-21(22)17-8-9-17/h6-7,10-13,15,17H,4-5,8-9,14H2,1-3H3/q-1.
What are the key properties of CID 153389575?
CID 153389575 has a molecular weight of 400.54 g/mol, XLogP of 6.05, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153389575 is sourced from PubChem (CID 153389575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).