C9H15F2N — CID 153390123
(2E,4E)-6,6-difluoro-N,5-dimethylhepta-2,4-dien-3-amine (PubChem CID 153390123) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is (2E,4E)-6,6-difluoro-N,5-dimethylhepta-2,4-dien-3-amine.
| Compound Name | (2E,4E)-6,6-difluoro-N,5-dimethylhepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 153390123 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (2E,4E)-6,6-difluoro-N,5-dimethylhepta-2,4-dien-3-amine |
| SMILES | C/C=C(\C=C(/C)C(C)(F)F)NC |
| InChI | InChI=1S/C9H15F2N/c1-5-8(12-4)6-7(2)9(3,10)11/h5-6,12H,1-4H3/b7-6+,8-5+ |
| InChIKey | DTUMUYXKAPBXMI-ZCOYIIAOSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|