About 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole
1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole (PubChem CID 153390249) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole |
| PubChem CID | 153390249 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole |
| SMILES | COc1nccc2c3c([nH]c12)C=CC(C)C3 |
| InChI | InChI=1S/C13H14N2O/c1-8-3-4-11-10(7-8)9-5-6-14-13(16-2)12(9)15-11/h3-6,8,15H,7H2,1-2H3 |
| InChIKey | FVFLKHXLACYEIF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole?
The IUPAC name of 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole (CID 153390249) is 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole.
What is the SMILES notation for 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole?
The canonical SMILES for 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole is COc1nccc2c3c([nH]c12)C=CC(C)C3.
What is the InChIKey of 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole?
The InChIKey is FVFLKHXLACYEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c1-8-3-4-11-10(7-8)9-5-6-14-13(16-2)12(9)15-11/h3-6,8,15H,7H2,1-2H3.
What are the key properties of 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole?
1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole has a molecular weight of 214.27 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-6-methyl-6,9-dihydro-5H-pyrido[3,4-b]indole is sourced from PubChem (CID 153390249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).