About (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide
(NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide (PubChem CID 153390304) has the molecular formula C15H16BrN3O
and a molecular weight of 334.22 g/mol. Its IUPAC name is (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide.
Molecular Properties
| Compound Name | (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide |
| PubChem CID | 153390304 |
| Molecular Formula | C15H16BrN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide |
| SMILES | C=C/N=C(\N=C/C)N1C(=O)C(C)(C)c2c(Br)cccc21 |
| InChI | InChI=1S/C15H16BrN3O/c1-5-17-14(18-6-2)19-11-9-7-8-10(16)12(11)15(3,4)13(19)20/h5-9H,1H2,2-4H3/b17-14+,18-6- |
| InChIKey | LTPYBGSTZFCPPA-FCTGSSPJSA-N |
| XLogP | 3.66 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide?
The IUPAC name of (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide (CID 153390304) is (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide.
What is the SMILES notation for (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide?
The canonical SMILES for (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide is C=C/N=C(\N=C/C)N1C(=O)C(C)(C)c2c(Br)cccc21.
What is the InChIKey of (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide?
The InChIKey is LTPYBGSTZFCPPA-FCTGSSPJSA-N. The full InChI is InChI=1S/C15H16BrN3O/c1-5-17-14(18-6-2)19-11-9-7-8-10(16)12(11)15(3,4)13(19)20/h5-9H,1H2,2-4H3/b17-14+,18-6-.
What are the key properties of (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide?
(NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide has a molecular weight of 334.22 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-4-bromo-N'-ethenyl-N-ethylidene-3,3-dimethyl-2-oxoindole-1-carboximidamide is sourced from PubChem (CID 153390304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).