C22H38N4 — CID 153390420
3-methyl-8-[5-(8-methyldecyl)pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 153390420) has the molecular formula C22H38N4 and a molecular weight of 358.57 g/mol. Its IUPAC name is 3-methyl-8-[5-(8-methyldecyl)pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-methyl-8-[5-(8-methyldecyl)pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 153390420 |
| Molecular Formula | C22H38N4 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | 3-methyl-8-[5-(8-methyldecyl)pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCC(C)CCCCCCCc1cnc(N2C3CCC2CN(C)C3)nc1 |
| InChI | InChI=1S/C22H38N4/c1-4-18(2)10-8-6-5-7-9-11-19-14-23-22(24-15-19)26-20-12-13-21(26)17-25(3)16-20/h14-15,18,20-21H,4-13,16-17H2,1-3H3 |
| InChIKey | DTCFKJJCOLJNKX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|