About ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane
ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane (PubChem CID 153390641) has the molecular formula C19H43NO5
and a molecular weight of 365.56 g/mol. Its IUPAC name is ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane.
Molecular Properties
| Compound Name | ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane |
| PubChem CID | 153390641 |
| Molecular Formula | C19H43NO5 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane |
| SMILES | C=CCOC(C)C.CC.CCOCCOCCOCCOCCNC |
| InChI | InChI=1S/C11H25NO4.C6H12O.C2H6/c1-3-13-6-7-15-10-11-16-9-8-14-5-4-12-2;1-4-5-7-6(2)3;1-2/h12H,3-11H2,1-2H3;4,6H,1,5H2,2-3H3;1-2H3 |
| InChIKey | AHMGOZYQNZJHRP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane?
The IUPAC name of ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane (CID 153390641) is ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane.
What is the SMILES notation for ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane?
The canonical SMILES for ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane is C=CCOC(C)C.CC.CCOCCOCCOCCOCCNC.
What is the InChIKey of ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane?
The InChIKey is AHMGOZYQNZJHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO4.C6H12O.C2H6/c1-3-13-6-7-15-10-11-16-9-8-14-5-4-12-2;1-4-5-7-6(2)3;1-2/h12H,3-11H2,1-2H3;4,6H,1,5H2,2-3H3;1-2H3.
What are the key properties of ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane?
ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane has a molecular weight of 365.56 g/mol, XLogP of 2.92, 16 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-methylethanamine;2-prop-2-enoxypropane is sourced from PubChem (CID 153390641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).