C27H37N — CID 153392437
6-methyl-2,3,4,9-tetrahydro-1H-carbazole;(4Z,6E)-2,7,8,8-tetramethyl-3-methylidenenona-1,4,6-triene (PubChem CID 153392437) has the molecular formula C27H37N and a molecular weight of 375.60 g/mol. Its IUPAC name is 6-methyl-2,3,4,9-tetrahydro-1H-carbazole;(4Z,6E)-2,7,8,8-tetramethyl-3-methylidenenona-1,4,6-triene.
| Compound Name | 6-methyl-2,3,4,9-tetrahydro-1H-carbazole;(4Z,6E)-2,7,8,8-tetramethyl-3-methylidenenona-1,4,6-triene |
|---|---|
| PubChem CID | 153392437 |
| Molecular Formula | C27H37N |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 6-methyl-2,3,4,9-tetrahydro-1H-carbazole;(4Z,6E)-2,7,8,8-tetramethyl-3-methylidenenona-1,4,6-triene |
| SMILES | C=C(C)C(=C)/C=C\C=C(/C)C(C)(C)C.Cc1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C14H22.C13H15N/c1-11(2)12(3)9-8-10-13(4)14(5,6)7;1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h8-10H,1,3H2,2,4-7H3;6-8,14H,2-5H2,1H3/b9-8-,13-10+; |
| InChIKey | DOFUDYLZBLEWSM-CVMRJGQRSA-N |
| XLogP | 8.02 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|