C29H44FN — CID 153392481
5-[(3Z,5E)-5-(2-fluoropropan-2-yl)-2,3-dimethylhepta-1,3,5-trien-4-yl]-4-methyl-1-[(4E)-5,6,6-trimethyl-3-methylidenehepta-1,4-dien-2-yl]-3,6-dihydro-2H-pyridine (PubChem CID 153392481) has the molecular formula C29H44FN and a molecular weight of 425.68 g/mol. Its IUPAC name is 5-[(3Z,5E)-5-(2-fluoropropan-2-yl)-2,3-dimethylhepta-1,3,5-trien-4-yl]-4-methyl-1-[(4E)-5,6,6-trimethyl-3-methylidenehepta-1,4-dien-2-yl]-3,6-dihydro-2H-pyridine.
| Compound Name | 5-[(3Z,5E)-5-(2-fluoropropan-2-yl)-2,3-dimethylhepta-1,3,5-trien-4-yl]-4-methyl-1-[(4E)-5,6,6-trimethyl-3-methylidenehepta-1,4-dien-2-yl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 153392481 |
| Molecular Formula | C29H44FN |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.35 |
| IUPAC Name | 5-[(3Z,5E)-5-(2-fluoropropan-2-yl)-2,3-dimethylhepta-1,3,5-trien-4-yl]-4-methyl-1-[(4E)-5,6,6-trimethyl-3-methylidenehepta-1,4-dien-2-yl]-3,6-dihydro-2H-pyridine |
| SMILES | C=C(/C=C(\C)C(C)(C)C)C(=C)N1CCC(C)=C(C(=C(\C)C(=C)C)/C(=C\C)C(C)(C)F)C1 |
| InChI | InChI=1S/C29H44FN/c1-14-26(29(12,13)30)27(23(7)19(2)3)25-18-31(16-15-20(25)4)24(8)21(5)17-22(6)28(9,10)11/h14,17H,2,5,8,15-16,18H2,1,3-4,6-7,9-13H3/b22-17+,26-14+,27-23- |
| InChIKey | QUNPZUZEYXUSJH-FFZQQHTDSA-N |
| XLogP | 8.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|