C21H19ClF4N2O6S — CID 153392545
4-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylacetyl]oxybutyl prop-2-enoate (PubChem CID 153392545) has the molecular formula C21H19ClF4N2O6S and a molecular weight of 538.90 g/mol. Its IUPAC name is 4-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylacetyl]oxybutyl prop-2-enoate.
| Compound Name | 4-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylacetyl]oxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 153392545 |
| Molecular Formula | C21H19ClF4N2O6S |
| Molecular Weight | 538.90 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 4-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylacetyl]oxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)CSc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C21H19ClF4N2O6S/c1-3-18(30)33-6-4-5-7-34-19(31)11-35-15-9-14(13(23)8-12(15)22)28-17(29)10-16(21(24,25)26)27(2)20(28)32/h3,8-10H,1,4-7,11H2,2H3 |
| InChIKey | APWYYWMCTLFWIK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|