C28H32N2O5S3 — CID 153392958
2-[(2E,5E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-5-[(2-propan-2-yl-1-benzofuran-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 153392958) has the molecular formula C28H32N2O5S3 and a molecular weight of 572.77 g/mol. Its IUPAC name is 2-[(2E,5E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-5-[(2-propan-2-yl-1-benzofuran-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(2E,5E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-5-[(2-propan-2-yl-1-benzofuran-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 153392958 |
| Molecular Formula | C28H32N2O5S3 |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | 2-[(2E,5E)-2-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-4-oxo-5-[(2-propan-2-yl-1-benzofuran-6-yl)methylidene]-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCCCCCCN1C(=O)/C(=c2\s/c(=C/c3ccc4cc(C(C)C)oc4c3)c(=O)n2CC(=O)O)SC1=S |
| InChI | InChI=1S/C28H32N2O5S3/c1-4-5-6-7-8-9-12-29-26(34)24(38-28(29)36)27-30(16-23(31)32)25(33)22(37-27)14-18-10-11-19-15-20(17(2)3)35-21(19)13-18/h10-11,13-15,17H,4-9,12,16H2,1-3H3,(H,31,32)/b22-14+,27-24+ |
| InChIKey | FKPVHGFZZNTGRN-XVUPJRCWSA-N |
| XLogP | 5.02 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|