About ethane;2-methyl-3-propylpyridine;1-propoxybutane
ethane;2-methyl-3-propylpyridine;1-propoxybutane (PubChem CID 153393005) has the molecular formula C22H47NO
and a molecular weight of 341.62 g/mol. Its IUPAC name is ethane;2-methyl-3-propylpyridine;1-propoxybutane.
Molecular Properties
| Compound Name | ethane;2-methyl-3-propylpyridine;1-propoxybutane |
| PubChem CID | 153393005 |
| Molecular Formula | C22H47NO |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 341.37 |
| IUPAC Name | ethane;2-methyl-3-propylpyridine;1-propoxybutane |
| SMILES | CC.CC.CC.CCCCOCCC.CCCc1cccnc1C |
| InChI | InChI=1S/C9H13N.C7H16O.3C2H6/c1-3-5-9-6-4-7-10-8(9)2;1-3-5-7-8-6-4-2;3*1-2/h4,6-7H,3,5H2,1-2H3;3-7H2,1-2H3;3*1-2H3 |
| InChIKey | YMZCUEZYFBPHEY-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-3-propylpyridine;1-propoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-3-propylpyridine;1-propoxybutane?
The IUPAC name of ethane;2-methyl-3-propylpyridine;1-propoxybutane (CID 153393005) is ethane;2-methyl-3-propylpyridine;1-propoxybutane.
What is the SMILES notation for ethane;2-methyl-3-propylpyridine;1-propoxybutane?
The canonical SMILES for ethane;2-methyl-3-propylpyridine;1-propoxybutane is CC.CC.CC.CCCCOCCC.CCCc1cccnc1C.
What is the InChIKey of ethane;2-methyl-3-propylpyridine;1-propoxybutane?
The InChIKey is YMZCUEZYFBPHEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C7H16O.3C2H6/c1-3-5-9-6-4-7-10-8(9)2;1-3-5-7-8-6-4-2;3*1-2/h4,6-7H,3,5H2,1-2H3;3-7H2,1-2H3;3*1-2H3.
What are the key properties of ethane;2-methyl-3-propylpyridine;1-propoxybutane?
ethane;2-methyl-3-propylpyridine;1-propoxybutane has a molecular weight of 341.62 g/mol, XLogP of 7.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3-propylpyridine;1-propoxybutane is sourced from PubChem (CID 153393005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).