C15H28O — CID 153393091
5,5,7,7-tetramethyl-2-prop-1-en-2-yloxyoct-1-ene (PubChem CID 153393091) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-2-prop-1-en-2-yloxyoct-1-ene.
| Compound Name | 5,5,7,7-tetramethyl-2-prop-1-en-2-yloxyoct-1-ene |
|---|---|
| PubChem CID | 153393091 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 5,5,7,7-tetramethyl-2-prop-1-en-2-yloxyoct-1-ene |
| SMILES | C=C(C)OC(=C)CCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H28O/c1-12(2)16-13(3)9-10-15(7,8)11-14(4,5)6/h1,3,9-11H2,2,4-8H3 |
| InChIKey | PWEGYLHUDSJSTF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|