C25H45N4O8+ — CID 153393691
[[(2R)-2-methoxycarbonyl-4-methylpentyl]amino]-[(3S,4R)-4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-oxoazanium (PubChem CID 153393691) has the molecular formula C25H45N4O8+ and a molecular weight of 529.66 g/mol. Its IUPAC name is [[(2R)-2-methoxycarbonyl-4-methylpentyl]amino]-[(3S,4R)-4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-oxoazanium.
| Compound Name | [[(2R)-2-methoxycarbonyl-4-methylpentyl]amino]-[(3S,4R)-4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-oxoazanium |
|---|---|
| PubChem CID | 153393691 |
| Molecular Formula | C25H45N4O8+ |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | [[(2R)-2-methoxycarbonyl-4-methylpentyl]amino]-[(3S,4R)-4-[(1-methoxy-4-methyl-1-oxopentan-2-yl)carbamoyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-oxoazanium |
| SMILES | COC(=O)C(CC(C)C)NC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1[N+](=O)NC[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C25H44N4O8/c1-15(2)10-17(22(31)35-8)12-26-29(34)20-14-28(24(33)37-25(5,6)7)13-18(20)21(30)27-19(11-16(3)4)23(32)36-9/h15-20H,10-14H2,1-9H3,(H-,26,27,30,34)/p+1/t17-,18-,19?,20-/m1/s1 |
| InChIKey | JEQBBEIUSGRPTL-LAURYZNVSA-O |
| XLogP | 2.04 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|