C23H43NO — CID 153393904
ethane;1-ethyl-2-[(3E)-5-methoxy-2,6-dimethylhepta-1,3,5-trien-3-yl]-5-(2-methylpropyl)piperidine (PubChem CID 153393904) has the molecular formula C23H43NO and a molecular weight of 349.60 g/mol. Its IUPAC name is ethane;1-ethyl-2-[(3E)-5-methoxy-2,6-dimethylhepta-1,3,5-trien-3-yl]-5-(2-methylpropyl)piperidine.
| Compound Name | ethane;1-ethyl-2-[(3E)-5-methoxy-2,6-dimethylhepta-1,3,5-trien-3-yl]-5-(2-methylpropyl)piperidine |
|---|---|
| PubChem CID | 153393904 |
| Molecular Formula | C23H43NO |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 349.33 |
| IUPAC Name | ethane;1-ethyl-2-[(3E)-5-methoxy-2,6-dimethylhepta-1,3,5-trien-3-yl]-5-(2-methylpropyl)piperidine |
| SMILES | C=C(C)/C(=C\C(OC)=C(C)C)C1CCC(CC(C)C)CN1CC.CC |
| InChI | InChI=1S/C21H37NO.C2H6/c1-9-22-14-18(12-15(2)3)10-11-20(22)19(16(4)5)13-21(23-8)17(6)7;1-2/h13,15,18,20H,4,9-12,14H2,1-3,5-8H3;1-2H3/b19-13+; |
| InChIKey | BGRBEONVLIARAL-XTWSRORZSA-N |
| XLogP | 6.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|