C26H14O2S3 — CID 15339411
8,10-diphenyl-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene-4,14-dicarbaldehyde (PubChem CID 15339411) has the molecular formula C26H14O2S3 and a molecular weight of 454.60 g/mol. Its IUPAC name is 8,10-diphenyl-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene-4,14-dicarbaldehyde.
| Compound Name | 8,10-diphenyl-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene-4,14-dicarbaldehyde |
|---|---|
| PubChem CID | 15339411 |
| Molecular Formula | C26H14O2S3 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 8,10-diphenyl-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene-4,14-dicarbaldehyde |
| SMILES | O=Cc1cc2c(s1)c1sc(C=O)cc1c1c(-c3ccccc3)sc(-c3ccccc3)c21 |
| InChI | InChI=1S/C26H14O2S3/c27-13-17-11-19-21-22(20-12-18(14-28)30-26(20)25(19)29-17)24(16-9-5-2-6-10-16)31-23(21)15-7-3-1-4-8-15/h1-14H |
| InChIKey | AWNUHIYKKGBDMM-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|