C21H21B2ClN4O4S — CID 153394242
CID 153394242 (PubChem CID 153394242) has the molecular formula C21H21B2ClN4O4S and a molecular weight of 482.57 g/mol.
| Compound Name | CID 153394242 |
|---|---|
| PubChem CID | 153394242 |
| Molecular Formula | C21H21B2ClN4O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | — |
| SMILES | [B]C([B])(Nc1cc(-c2cccn(CCC(=O)O)c2=O)nn1C(=O)C(C)(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H21B2ClN4O4S/c1-20(2,3)19(32)28-16(25-21(22,23)14-6-7-15(24)33-14)11-13(26-28)12-5-4-9-27(18(12)31)10-8-17(29)30/h4-7,9,11,25H,8,10H2,1-3H3,(H,29,30) |
| InChIKey | NJEDOFPBXPLEEU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|