About CID 153394242
CID 153394242 (PubChem CID 153394242) has the molecular formula C21H21B2ClN4O4S
and a molecular weight of 482.57 g/mol.
Molecular Properties
| Compound Name | CID 153394242 |
| PubChem CID | 153394242 |
| Molecular Formula | C21H21B2ClN4O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | — |
| SMILES | [B]C([B])(Nc1cc(-c2cccn(CCC(=O)O)c2=O)nn1C(=O)C(C)(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H21B2ClN4O4S/c1-20(2,3)19(32)28-16(25-21(22,23)14-6-7-15(24)33-14)11-13(26-28)12-5-4-9-27(18(12)31)10-8-17(29)30/h4-7,9,11,25H,8,10H2,1-3H3,(H,29,30) |
| InChIKey | NJEDOFPBXPLEEU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153394242 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153394242?
The IUPAC name of CID 153394242 (CID 153394242) is not available.
What is the SMILES notation for CID 153394242?
The canonical SMILES for CID 153394242 is [B]C([B])(Nc1cc(-c2cccn(CCC(=O)O)c2=O)nn1C(=O)C(C)(C)C)c1ccc(Cl)s1.
What is the InChIKey of CID 153394242?
The InChIKey is NJEDOFPBXPLEEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21B2ClN4O4S/c1-20(2,3)19(32)28-16(25-21(22,23)14-6-7-15(24)33-14)11-13(26-28)12-5-4-9-27(18(12)31)10-8-17(29)30/h4-7,9,11,25H,8,10H2,1-3H3,(H,29,30).
What are the key properties of CID 153394242?
CID 153394242 has a molecular weight of 482.57 g/mol, XLogP of 3.15, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153394242 is sourced from PubChem (CID 153394242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).