C48H35N5 — CID 153395124
N-phenyl-N-(4-phenylphenyl)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]benzotriazol-5-amine (PubChem CID 153395124) has the molecular formula C48H35N5 and a molecular weight of 681.84 g/mol. Its IUPAC name is N-phenyl-N-(4-phenylphenyl)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]benzotriazol-5-amine.
| Compound Name | N-phenyl-N-(4-phenylphenyl)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]benzotriazol-5-amine |
|---|---|
| PubChem CID | 153395124 |
| Molecular Formula | C48H35N5 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | N-phenyl-N-(4-phenylphenyl)-2-[4-(N-(4-phenylphenyl)anilino)phenyl]benzotriazol-5-amine |
| SMILES | c1ccc(-c2ccc(N(c3ccccc3)c3ccc(-n4nc5ccc(N(c6ccccc6)c6ccc(-c7ccccc7)cc6)cc5n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H35N5/c1-5-13-36(14-6-1)38-21-25-42(26-22-38)51(40-17-9-3-10-18-40)44-29-31-45(32-30-44)53-49-47-34-33-46(35-48(47)50-53)52(41-19-11-4-12-20-41)43-27-23-39(24-28-43)37-15-7-2-8-16-37/h1-35H |
| InChIKey | GOZNEWVCWZWBBS-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |