About 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide
2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide (PubChem CID 153395201) has the molecular formula C6H11FN2O
and a molecular weight of 146.16 g/mol. Its IUPAC name is 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide |
| PubChem CID | 153395201 |
| Molecular Formula | C6H11FN2O |
| Molecular Weight | 146.16 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@H]1CNC[C@H]1F |
| InChI | InChI=1S/C6H11FN2O/c7-5-3-9-2-4(5)1-6(8)10/h4-5,9H,1-3H2,(H2,8,10)/t4-,5+/m0/s1 |
| InChIKey | OFFMIGRIZDQALN-CRCLSJGQSA-N |
| XLogP | -0.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide?
The IUPAC name of 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide (CID 153395201) is 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide.
What is the SMILES notation for 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide?
The canonical SMILES for 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide is NC(=O)C[C@H]1CNC[C@H]1F.
What is the InChIKey of 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide?
The InChIKey is OFFMIGRIZDQALN-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H11FN2O/c7-5-3-9-2-4(5)1-6(8)10/h4-5,9H,1-3H2,(H2,8,10)/t4-,5+/m0/s1.
What are the key properties of 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide?
2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide has a molecular weight of 146.16 g/mol, XLogP of -0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4S)-4-fluoropyrrolidin-3-yl]acetamide is sourced from PubChem (CID 153395201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).