C27H31FN4O4S — CID 153395667
fluoro 3-[3-amino-4-[amino(methyl)amino]-5-hydroxyphenyl]-3-[4-methyl-3-[(4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl)methyl]phenyl]propanoate (PubChem CID 153395667) has the molecular formula C27H31FN4O4S and a molecular weight of 526.63 g/mol. Its IUPAC name is fluoro 3-[3-amino-4-[amino(methyl)amino]-5-hydroxyphenyl]-3-[4-methyl-3-[(4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl)methyl]phenyl]propanoate.
| Compound Name | fluoro 3-[3-amino-4-[amino(methyl)amino]-5-hydroxyphenyl]-3-[4-methyl-3-[(4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl)methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 153395667 |
| Molecular Formula | C27H31FN4O4S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | fluoro 3-[3-amino-4-[amino(methyl)amino]-5-hydroxyphenyl]-3-[4-methyl-3-[(4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl)methyl]phenyl]propanoate |
| SMILES | Cc1ccc(C(CC(=O)OF)c2cc(N)c(N(C)N)c(O)c2)cc1CN1CC(C)Oc2ccccc2S1 |
| InChI | InChI=1S/C27H31FN4O4S/c1-16-8-9-18(10-20(16)15-32-14-17(2)35-24-6-4-5-7-25(24)37-32)21(13-26(34)36-28)19-11-22(29)27(31(3)30)23(33)12-19/h4-12,17,21,33H,13-15,29-30H2,1-3H3 |
| InChIKey | KVWSCCSGTQFMCD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|