C13H21N3O — CID 153395932
[6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea (PubChem CID 153395932) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea.
| Compound Name | [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 153395932 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea |
| SMILES | Cc1cc(C(C)C)c(NC(N)=O)c(C(C)C)n1 |
| InChI | InChI=1S/C13H21N3O/c1-7(2)10-6-9(5)15-11(8(3)4)12(10)16-13(14)17/h6-8H,1-5H3,(H3,14,16,17) |
| InChIKey | FDSMDMASRCNFED-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |