About [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea
[6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea (PubChem CID 153395932) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea.
Molecular Properties
| Compound Name | [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea |
| PubChem CID | 153395932 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea |
| SMILES | Cc1cc(C(C)C)c(NC(N)=O)c(C(C)C)n1 |
| InChI | InChI=1S/C13H21N3O/c1-7(2)10-6-9(5)15-11(8(3)4)12(10)16-13(14)17/h6-8H,1-5H3,(H3,14,16,17) |
| InChIKey | FDSMDMASRCNFED-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea?
The IUPAC name of [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea (CID 153395932) is [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea.
What is the SMILES notation for [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea?
The canonical SMILES for [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea is Cc1cc(C(C)C)c(NC(N)=O)c(C(C)C)n1.
What is the InChIKey of [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea?
The InChIKey is FDSMDMASRCNFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-7(2)10-6-9(5)15-11(8(3)4)12(10)16-13(14)17/h6-8H,1-5H3,(H3,14,16,17).
What are the key properties of [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea?
[6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea has a molecular weight of 235.33 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-2,4-di(propan-2-yl)-3-pyridinyl]urea is sourced from PubChem (CID 153395932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).