About [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid
[(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid (PubChem CID 153396463) has the molecular formula C11H15BN2O4
and a molecular weight of 250.06 g/mol. Its IUPAC name is [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid.
Molecular Properties
| Compound Name | [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid |
| PubChem CID | 153396463 |
| Molecular Formula | C11H15BN2O4 |
| Molecular Weight | 250.06 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid |
| SMILES | Cc1cccc2c1OC[C@H]2C[C@H](NN=O)B(O)O |
| InChI | InChI=1S/C11H15BN2O4/c1-7-3-2-4-9-8(6-18-11(7)9)5-10(12(15)16)13-14-17/h2-4,8,10,15-16H,5-6H2,1H3,(H,13,17)/t8-,10+/m1/s1 |
| InChIKey | JUKQPUWIWUVLFC-SCZZXKLOSA-N |
| XLogP | 0.51 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.06 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid?
The IUPAC name of [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid (CID 153396463) is [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid.
What is the SMILES notation for [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid?
The canonical SMILES for [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid is Cc1cccc2c1OC[C@H]2C[C@H](NN=O)B(O)O.
What is the InChIKey of [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid?
The InChIKey is JUKQPUWIWUVLFC-SCZZXKLOSA-N. The full InChI is InChI=1S/C11H15BN2O4/c1-7-3-2-4-9-8(6-18-11(7)9)5-10(12(15)16)13-14-17/h2-4,8,10,15-16H,5-6H2,1H3,(H,13,17)/t8-,10+/m1/s1.
What are the key properties of [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid?
[(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid has a molecular weight of 250.06 g/mol, XLogP of 0.51, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-[(3S)-7-methyl-2,3-dihydro-1-benzofuran-3-yl]-1-(2-oxohydrazinyl)ethyl]boronic acid is sourced from PubChem (CID 153396463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).