C25H21FN4O2S2 — CID 153396823
[8-ethyl-4-oxo-6-(3-pyridin-4-ylpropoxy)-2-thieno[2,3-c]pyridin-5-ylquinazolin-3-yl] thiohypofluorite (PubChem CID 153396823) has the molecular formula C25H21FN4O2S2 and a molecular weight of 492.60 g/mol. Its IUPAC name is [8-ethyl-4-oxo-6-(3-pyridin-4-ylpropoxy)-2-thieno[2,3-c]pyridin-5-ylquinazolin-3-yl] thiohypofluorite.
| Compound Name | [8-ethyl-4-oxo-6-(3-pyridin-4-ylpropoxy)-2-thieno[2,3-c]pyridin-5-ylquinazolin-3-yl] thiohypofluorite |
|---|---|
| PubChem CID | 153396823 |
| Molecular Formula | C25H21FN4O2S2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | [8-ethyl-4-oxo-6-(3-pyridin-4-ylpropoxy)-2-thieno[2,3-c]pyridin-5-ylquinazolin-3-yl] thiohypofluorite |
| SMILES | CCc1cc(OCCCc2ccncc2)cc2c(=O)n(SF)c(-c3cc4ccsc4cn3)nc12 |
| InChI | InChI=1S/C25H21FN4O2S2/c1-2-17-12-19(32-10-3-4-16-5-8-27-9-6-16)14-20-23(17)29-24(30(34-26)25(20)31)21-13-18-7-11-33-22(18)15-28-21/h5-9,11-15H,2-4,10H2,1H3 |
| InChIKey | VGEKXDMCNITKSD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|